15 results for "Additional Apoptosis-related Compounds" in 产品
Additional Apoptosis-related Compounds
Non-selective PI 3-kinase inhibitor
| Chemical Name: | 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one |
| Purity: | ≥98% |
Antimalarial; inhibits apoptosis and autophagy
| Chemical Name: | N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt |
| Purity: | ≥98% |
Mitochondrial VDAC modulator; also Ferroptosis activator
| Chemical Name: | 2-[1-[4-[2-(4-Chlorophenoxy)acetyl]-1-piperazinyl]ethyl]-3-(2-ethoxyphenyl)-4(3H)-quinazolinone |
| Purity: | ≥98% |
Class III PI 3-kinase inhibitor; also inhibits autophagy
| Alternate Names: | 3-MA |
| Chemical Name: | 3-Methyl-3H-purin-6-amine |
| Purity: | ≥98% |
Selective inhibitor of erastin induced ferroptosis
| Chemical Name: | Ethyl 3-amino-4-(cyclohexylamino)benzoate |
| Purity: | ≥98% |
Selective dynamin inhibitor; attenuates mitochondrial division and apoptosis
| Chemical Name: | 3-(2,4-Dichloro-5-methoxyphenyl)-2,3-dihydro-2-thioxo-4(1H)-quinazolinone |
| Purity: | ≥98% |
Necroptosis inhibitor; also inhibits pyroptosis
| Chemical Name: | (2E)-N-[4-[[(3-Methoxy-2-pyrazinyl)amino]sulfonyl]phenyl]-3-(5-nitro-2-thienyl)-2-propenamide |
| Purity: | ≥98% |
VGF-derived peptide
| Purity: | ≥95% |
Selective LPA2 receptor non-lipid agonist
| Chemical Name: | 2-[[3-(1,3-dioxo-1H-benz[de]isoquinolin-2(3H)-yl)propyl]thio]benzoic acid |
| Purity: | ≥98% |
Potent ferroptosis inhibitor
| Chemical Name: | N-[(3-Chlorophenyl)methyl]spiro[piperidine-4,2'(1'H)-quinoxalin]-3'-amine hydrochloride |
| Purity: | ≥98% |
Selectively kills mutant HRAS-expressing cells; glutathione peroxidase inhibitor; induces ferroptosis
| Chemical Name: | [4-[Bis(4-chlorophenyl)methyl]-1-piperazinyl](5-methyl-4-nitro-3-isoxazolyl)methanone |
| Purity: | ≥98% |
Potent and metabolically stable RIP1 kinase inhibitor
| Chemical Name: | N-Hydroxy-2,2-dimethyl-N-(phenylmethyl)butanamide |
| Purity: | ≥98% |
Potent and selective PD-1/PD-L1 interaction inhibitor
| Chemical Name: | 2-[[[5-Chloro-2-[(5-cyano-3-pyridinyl)methoxy]-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]phenyl]methyl][3-(dimethylamino)propyl]amino]ethanesulfonic acid |
| Purity: | ≥98% |
Peptide inhibitor of the PD-1 signaling pathway
| Purity: | ≥95% |
Induces ferroptosis; inhibits FSP1
| Chemical Name: | 3-(4-Bromophenyl)-6-((4-(4-methoxyphenyl)piperazin-1-yl)methyl)thiazolo[2,3-c][1,2,4]triazole |
| Purity: | ≥98% |