13 results for "DNA, RNA and Protein Synthesis Compounds Small Molecules and Peptides" in 产品
DNA, RNA and Protein Synthesis Compounds Small Molecules and Peptides
RNA, DNA and protein synthesis are fundamental processes necessary for all life.
RNA synthesis (transcription) begins by uncoiling a section of DNA that will be used as the template. RNA polymerase binds to a promoter sequence and initiates separation of the DNA double helix. Complementary ribonucleotides align and RNA polymerase catalyzes their polymerization. The newly synthesized RNA strand undergoes post-transcriptional processing before it leaves the nucleus.
Protein synthesis ...
Synthetic thymidine analog; used for cell proliferation assays
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥98% |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% |
Photoreactive uridine analog for RNA sequencing
| Chemical Name: | 4-Thiouridine |
| Purity: | ≥98% |
Hypoxia-activated DNA alkylating agent prodrug
| Chemical Name: | (1-Methyl-2-nitro-1H-imidazol-5-yl)methyl N,N'-bis(2-bromoethyl)phosphorodiamidate |
| Purity: | ≥98% |
Antibiotic; inhibits 50S ribosomal subunit formation and elongation at transpeptidation
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥98% |
Alkylating agent; chemotherapeutic
| Chemical Name: | 2-[bis(2-Chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide |
| Purity: | ≥98% |
HIV RNA splicing modulator
| Chemical Name: | 8-Chloro-N-[4-(trifluoromethoxy)phenyl]-2-quinolinamine |
| Purity: | ≥98% |
RNA conformation probe; reagent for COMRADES RNA platform
| Alternate Names: | psoralen-triethylene glycol azide |
| Chemical Name: | 3-(13-Azido-5,8,11-trioxa-2-azatridec-1-yl)-2,5,9-trimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Purity: | ≥98% |
Thymidine analog for labeling DNA; can be linked to a fluorophore by click chemistry
| Chemical Name: | 5-ethynyl-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥95% |
Potent and selective herpes simplex virus (HSV) helicase primase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-4-methyl-2-thiazolyl]-N-methyl-4-(2-pyridinyl)benzeneacetamide |
| Purity: | ≥98% |
Selective SMN2 gene splicing modifier
| Chemical Name: | 7-(4,7-Diazaspiro[2.5]oct-7-yl)-2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Purity: | ≥98% |
Metabolite generated by cytosol nonspecific dipeptidase (CNDP2) during intense exercise
| Chemical Name: | N-[(2S)-2-Hydroxy-1-oxopropyl]-L-phenylalanine |
| Purity: | ≥95% |
Chemoproteomic reagent, clickable electrophilic purine for RNA binding profiling in live cells
| Chemical Name: | 2,6-Dichloro-7-(2-propyn-1-yl)-7H-purine |
| Purity: | ≥98% |