38 results for "Biochemicals and Molecular Biology Compounds Small Molecules and Peptides" in 产品
Biochemicals and Molecular Biology Compounds Small Molecules and Peptides
Cell-permeable Ca2+ chelator
| Chemical Name: | 1,2-Bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid tetrakis(acetoxymethyl ester) |
| Purity: | ≥95% |
Viral transduction enhancer
| Alternate Names: | Hexadimethrine bromide |
| Chemical Name: | 1,5-Dimethyl-1,5-diazaundecamethylene polymethobromide |
| Purity: | ≥95% |
Inhibits β-catenin-responsive transcription (CRT)
| Chemical Name: | 5-[[2,5-Dimethyl-1-(3-pyridinyl)-1H-pyrrol-3-yl]methylene]-3-phenyl-2,4-thiazolidinedion |
| Purity: | ≥98% |
Synthetic thymidine analog; used for cell proliferation assays
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥98% |
Iron chelator; also hypoxia mimetic and neuroprotectant
| Chemical Name: | N4-[5-[[4-[[5-(Acetylhydroxyamino)pentyl]amino-1,4-dioxobutyl]hydroxyamino]pentyl]-N1-(5-aminopentyl)-N1-hydroxybutanediamide methanesulfonate |
Polyethylenimine (PEI) transfection reagent, chemically-defined
| Chemical Name: | Poly[imino(1,2-ethanediyl)] hydrochloride |
Cell-permeable Zn2+ chelator; also inhibits RNA binding protein Lin28
| Chemical Name: | N,N,N',N'-Tetrakis(2-pyridylmethyl)ethylenediamine |
| Purity: | ≥97% |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% |
Photoreactive uridine analog for RNA sequencing
| Chemical Name: | 4-Thiouridine |
| Purity: | ≥98% |
Reagent for synthetic biology; converts cysteine to dehydroalanine
| Chemical Name: | 2,5-Dibromohexanediamide |
Bacterial peptidoglycan derivative; suitable for 'click'-conjugation to fluorescent dyes
| Chemical Name: | (2R)-2-(((3R,4R,5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(pent-4-ynamido)tetrahydro-2H-pyran-4-yl)oxy)propanoic acid |
| Purity: | ≥95% |
Forms monovalent ion channels in lipid bilyers; antifungal
| Chemical Name: | (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-Amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
| Purity: | ≥90% |
Liposome/lipoplex transfection enhancer
| Chemical Name: | (9Z)-1,1'-[(1R)-1-[[[(2-Aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl] 9-octadecenoic acid ester |
| Purity: | ≥95% |
Azide-containing monosaccharide building block; used as glycoprotein, glycolipid and glycoRNA probe
| Chemical Name: | 2-[(2-Azidoacetyl)amino]-2-deoxy-D-mannopyranose-1,3,4,6-tetraacetate |
| Purity: | ≥95% |
Photo-crosslinking probe for studying glycoproteins and glycolipids
| Chemical Name: | 2-Deoxy-2-[[3-(3-methyl-3H-diazirin-3-yl)-1-oxopropyl]amino]-D-mannopyranose-1,3,4,6-tetraacetate |
| Purity: | ≥98% |
Cyclic complexing agent
| Purity: | ≥98% |
Cationic agent for liposome and LNP formation
| Alternate Names: | 1,2-dioleoyl-3-trimethylammoniumpropane |
| Chemical Name: | N,N,N-Trimethyl-2,3-bis(oleoyloxy)propan-1-aminium chloride |
| Purity: | ≥90% |
NHS ester hapten for labeling amino groups
| Chemical Name: | (3β,5β,12β)-3-[2-[[6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]amino]-2-oxoethoxy]-12,14-dihydroxycard-20(22)-enolide |
| Purity: | ≥80% |
PreQ1 with biotin handle for RNA labeling and purification
| Chemical Name: | N-(6-(((2-Amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl)amino)hexyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide |
| Purity: | ≥95% |
preQ1 with alkyne handle for click chemistry
| Chemical Name: | N-[6-[[(2-Amino-4,7-dihydro-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]amino]hexyl]-3-(2-propyn-1-yloxy)propanamide |
| Purity: | ≥95% |
preQ1 with azide handle for click chemistry
| Chemical Name: | N-[6-[[(2-Amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]amino]hexyl]-3-(2-azidoethoxy)propanamide |
| Purity: | ≥95% |
Alkyne containing monosaccharide building block; used in BOCTAG
| Chemical Name: | 2-Deoxy-2-[(1-oxo-5-hexyn-1-yl)amino]-D-galactopyranose-1,3,4,6-tetraacetate |
| Purity: | ≥95% |
Metabolic chemical reporter for studying glycosylation and glycoproteins
| Chemical Name: | 2-Deoxy-2-[(1-oxo-4-pentyn-1-yl)amino]-D-galactopyranose-1,3,4,6-tetraacetate |
| Purity: | ≥95% |
Protein transfection reagent
Chemoproteomic reagent, clickable electrophilic purine for RNA binding profiling in live cells
| Chemical Name: | 2,6-Dichloro-7-(2-propyn-1-yl)-7H-purine |
| Purity: | ≥98% |