48 results for "Biochemicals and Molecular Biology Compounds Small Molecules and Peptides" in 产品
Biochemicals and Molecular Biology Compounds Small Molecules and Peptides
Photosensitizer for proximity labeling experiments, NHS reactive group
| Chemical Name: | N-(2-(2-((6-Chlorohexyl)oxy)ethoxy)ethyl)-2-(10-methyl-2,4-dioxo-4,10-dihydropyrimido[4,5-b]quinolin-3(2H)-yl)acetamide |
| Purity: | ≥95% |
Photosensitizer for proximity labeling experiments, Alkyne reactive group
| Chemical Name: | 3-(Hex-5-yn-1-yl)-10-methylpyrimido[4,5-b]quinoline-2,4(3H,10H)-dione |
| Purity: | ≥95% |
mTOR inhibitor; immunosuppressant
| Chemical Name: | (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-Hexadecahydro-9,27-dihydroxy-3-[(1R)-2-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethyl]-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-23,27-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| Purity: | ≥98% |
Cell-permeable Ca2+ chelator
| Chemical Name: | 1,2-Bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid tetrakis(acetoxymethyl ester) |
| Purity: | ≥95% |
Viral transduction enhancer
| Alternate Names: | Hexadimethrine bromide |
| Chemical Name: | 1,5-Dimethyl-1,5-diazaundecamethylene polymethobromide |
| Purity: | ≥95% |
Inhibits β-catenin-responsive transcription (CRT)
| Chemical Name: | 5-[[2,5-Dimethyl-1-(3-pyridinyl)-1H-pyrrol-3-yl]methylene]-3-phenyl-2,4-thiazolidinedion |
| Purity: | ≥98% |
Polyethylenimine (PEI) transfection reagent, chemically-defined
| Chemical Name: | Poly[imino(1,2-ethanediyl)] hydrochloride |
Synthetic thymidine analog; used for cell proliferation assays
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥98% |
Iron chelator; also hypoxia mimetic and neuroprotectant
| Chemical Name: | N4-[5-[[4-[[5-(Acetylhydroxyamino)pentyl]amino-1,4-dioxobutyl]hydroxyamino]pentyl]-N1-(5-aminopentyl)-N1-hydroxybutanediamide methanesulfonate |
Cell-permeable Zn2+ chelator; also inhibits RNA binding protein Lin28
| Chemical Name: | N,N,N',N'-Tetrakis(2-pyridylmethyl)ethylenediamine |
| Purity: | ≥97% |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% |
Photoreactive uridine analog for RNA sequencing
| Chemical Name: | 4-Thiouridine |
| Purity: | ≥98% |
Cyclic complexing agent
| Purity: | ≥98% |
Reagent for synthetic biology; converts cysteine to dehydroalanine
| Chemical Name: | 2,5-Dibromohexanediamide |
α2 integrin inhibitor; anti-angiogenic
| Chemical Name: | 3-Cyano-N-(3-cyano-4-methyl-1H-indol-7-yl)benzenesulfonamide |
| Purity: | ≥98% |
Bacterial peptidoglycan derivative; suitable for 'click'-conjugation to fluorescent dyes
| Chemical Name: | (2R)-2-(((3R,4R,5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(pent-4-ynamido)tetrahydro-2H-pyran-4-yl)oxy)propanoic acid |
| Purity: | ≥95% |
Forms monovalent ion channels in lipid bilyers; antifungal
| Chemical Name: | (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-Amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
| Purity: | ≥90% |
Liposome/lipoplex transfection enhancer
| Chemical Name: | (9Z)-1,1'-[(1R)-1-[[[(2-Aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl] 9-octadecenoic acid ester |
| Purity: | ≥95% |
Cationic agent for liposome and LNP formation
| Alternate Names: | 1,2-dioleoyl-3-trimethylammoniumpropane |
| Chemical Name: | N,N,N-Trimethyl-2,3-bis(oleoyloxy)propan-1-aminium chloride |
| Purity: | ≥90% |
Azide-containing monosaccharide building block; used as glycoprotein, glycolipid and glycoRNA probe
| Chemical Name: | 2-[(2-Azidoacetyl)amino]-2-deoxy-D-mannopyranose-1,3,4,6-tetraacetate |
| Purity: | ≥95% |
Photo-crosslinking probe for studying glycoproteins and glycolipids
| Chemical Name: | 2-Deoxy-2-[[3-(3-methyl-3H-diazirin-3-yl)-1-oxopropyl]amino]-D-mannopyranose-1,3,4,6-tetraacetate |
| Purity: | ≥98% |
Minimal recognition sequence for integrin binding; potent integrin inhibitor
| Purity: | ≥95% |
Asialoglycoprotein receptor ligand with PEG4 linker and azide group for onward chemistry
| Chemical Name: | 2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethyl 2-(acetylamino)-2-deoxy-β-D-galactopyranoside |
| Purity: | ≥95% |
NHS ester hapten for labeling amino groups
| Chemical Name: | (3β,5β,12β)-3-[2-[[6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]amino]-2-oxoethoxy]-12,14-dihydroxycard-20(22)-enolide |
| Purity: | ≥80% |
Immunogenic glycoprotein used as model antigen for immunization and vaccination research.
| Alternate Names: | OVA peptide |
| Purity: | ≥95% |