6 results for "Carbonic Anhydrase II/CA2 Small Molecules and Peptides" in Products
Carbonic Anhydrase II/CA2 Small Molecules and Peptides
Carbonic anhydrases catalyze the reversible reaction of CO2 + H2O = HCO3- + H+, which is fundamental to many processes such as respiration, renal tubular acidification and bone resorption. Human members of the CAs are secreted (CA6), membrane-bound (CA4, 9 to 12 and 14), cytosolic (CA1 to 3, 7, 8 and 13) or mitochondrial (CA5A and 5B). Some CAs may...
Carbonic anhydrase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-1,3,4-thiadiazol-2-yl]acetamide |
| Purity: | ≥98% |
GluK1 antagonist; inhibits carbonic anhydrase (CA) II and IV; also positive allosteric modulator of GABAA receptors
| Alternate Names: | Topamax |
| Chemical Name: | 2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose sulfamate |
| Purity: | ≥98% |
Potent steroid sulfatase inhibitor; also inhibits carbonic anhydrase II
| Chemical Name: | 6,7,8,9,10,11-Hexahydro-6-oxobenzo[b]cyclohepta[d]pyran-3-yl sulfamate |
| Purity: | ≥98% |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% |
Selective and potent COX-2 inhibitor
| Chemical Name: | 4-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide |
| Purity: | ≥98% |
Potent human carbonic anhydrase II Degrader (PROTAC®)
| Chemical Name: | 4-(Aminosulfonyl)-N-[12-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]amino]dodecyl]benzamide |
| Purity: | ≥98% |