209 results for "Carbonic Anhydrase II/CA2" in Products
Carbonic Anhydrase II/CA2 Products
Carbonic anhydrases catalyze the reversible reaction of CO2 + H2O = HCO3- + H+, which is fundamental to many processes such as respiration, renal tubular acidification and bone resorption. Human members of the CAs are secreted (CA6), membrane-bound (CA4, 9 to 12 and 14), cytosolic (CA1 to 3, 7, 8 and 13) or mitochondrial (CA5A and 5B). Some CAs may serve as markers for tumors and hypoxia. A subset of CAs lack CA activity due to point mutations but retain esterase function.
| Reactivity: | Human, Mouse |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, ELISA, Simple Western |
![Western Blot: Carbonic Anhydrase II/CA2 Antibody [NB600-919]](https://resources.rndsystems.com/images/products/Carbonic-Anhydrase-II-CA2-Antibody-Western-Blot-NB600-919-img0008.jpg "Western Blot: Carbonic Anhydrase II/CA2 Antibody [NB600-919]")
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human |
| Details: | Sheep IgG Polyclonal |
| Applications: | IHC, WB, Simple Western, IP |
| Reactivity: | Human |
| Source: | E. coli |
| Accession #: | P00918 |
| Applications: | Enzyme Activity |
| Reactivity: | Human, Bovine |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, ELISA |
![Western Blot: Carbonic Anhydrase II/CA2 Antibody [NB600-943]](https://resources.rndsystems.com/images/products/Carbonic-Anhydrase-II-CA2-Antibody-Western-Blot-NB600-943-img0002.jpg "Western Blot: Carbonic Anhydrase II/CA2 Antibody [NB600-943]")
| Reactivity: | Human, Mouse, Rat |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB |
![Western Blot: Carbonic Anhydrase II/CA2 Antibody [NBP2-52736]](https://resources.rndsystems.com/images/products/Carbonic-Anhydrase-II-CA2-Antibody-Western-Blot-NBP2-52736-img0004.jpg "Western Blot: Carbonic Anhydrase II/CA2 Antibody [NBP2-52736]")
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% |
Recombinant Monoclonal Antibody
| Reactivity: | Human |
| Details: | Mouse IgG1 Monoclonal Clone #11A2-R |
| Applications: | IHC, WB, ICC/IF |
GluK1 antagonist; inhibits carbonic anhydrase (CA) II and IV; also positive allosteric modulator of GABAA receptors
| Alternate Names: | Topamax |
| Chemical Name: | 2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose sulfamate |
| Purity: | ≥98% |
Selective and potent COX-2 inhibitor
| Chemical Name: | 4-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide |
| Purity: | ≥98% |
Carbonic anhydrase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-1,3,4-thiadiazol-2-yl]acetamide |
| Purity: | ≥98% |
Potent steroid sulfatase inhibitor; also inhibits carbonic anhydrase II
| Chemical Name: | 6,7,8,9,10,11-Hexahydro-6-oxobenzo[b]cyclohepta[d]pyran-3-yl sulfamate |
| Purity: | ≥98% |
Recombinant Monoclonal Antibody
| Reactivity: | Mouse |
| Details: | Rabbit IgG Monoclonal Clone #003 |
| Applications: | IHC |
![Immunohistochemistry-Paraffin: Carbonic Anhydrase II/CA2 Antibody (003) [NBP2-90677]](https://resources.rndsystems.com/images/products/Carbonic-Anhydrase-II-CA2-Antibody-003-Immunohistochemistry-Paraffin-NBP2-90677-img0004.jpg "Immunohistochemistry-Paraffin: Carbonic Anhydrase II/CA2 Antibody (003) [NBP2-90677]")
Potent human carbonic anhydrase II Degrader (PROTAC®)
| Chemical Name: | 4-(Aminosulfonyl)-N-[12-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]amino]dodecyl]benzamide |
| Purity: | ≥98% |
Recombinant Monoclonal Antibody
| Reactivity: | Human |
| Details: | Rabbit IgG Monoclonal Clone #001 |
| Applications: | WB, IP |
![Western Blot: Carbonic Anhydrase II/CA2 Antibody (001) [NBP2-89522]](https://resources.rndsystems.com/images/products/Carbonic-Anhydrase-II-CA2-Antibody-001-Western-Blot-NBP2-89522-img0001.jpg "Western Blot: Carbonic Anhydrase II/CA2 Antibody (001) [NBP2-89522]")
| Reactivity: | Mouse |
| Sensitivity: | 0.94 ng/mL |
| Assay Range: | 1.56 - 100 ng/mL |
| Applications: | ELISA |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human, Mouse |
| Details: | Rat IgG2A Monoclonal Clone #322706 |
| Applications: | IHC, WB |
| Reactivity: | Human |
| Details: | Sheep IgG Polyclonal |
| Applications: | IHC, WB, IP |