3 results for "Ubiquitin Ligase (E3) Inhibitors Small Molecules and Peptides" in Products
Ubiquitin Ligase (E3) Inhibitors Small Molecules and Peptides
Ubiquitin E3 ligases (EC 6.3.2.19) attach ubiquitin molecules onto lysine residues of proteins in order to target the protein for a specific cellular process, such as proteasomal degradation or an alteration in subcellular localization. In addition to the specific ubiquitin ligases such as MDM2, E3A and anaphase-promoting complex (APC), many other proteins also contain domains that possess ubiquitin ligase activity. Almost all known ubiquitin E3 ligases contain one of three domains: a HECT, ...
Cereblon binder; induces ubiquitination and degradation of CK1α by E3 ubiquitin ligase
| Chemical Name: | 3-(4-Amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione |
| Purity: | ≥98% |
Cereblon binder; also TNF-α inhibitor and antiangiogenic
| Chemical Name: | 4-Amino-2-(2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione |
| Purity: | ≥98% |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% |