29 results for "DNA, RNA and Protein Synthesis Compounds" in Products
DNA, RNA and Protein Synthesis Compounds
RNA, DNA and protein synthesis are fundamental processes necessary for all life.
RNA synthesis (transcription) begins by uncoiling a section of DNA that will be used as the template. RNA polymerase binds to a promoter sequence and initiates separation of the DNA double helix. Complementary ribonucleotides align and RNA polymerase catalyzes their polymerization. The newly synthesized RNA strand undergoes post-transcriptional processing before it leaves the nucleus.
Protein synthesis ...
Non-selective protein kinase inhibitor
| Alternate Names: | AM-2282 |
| Chemical Name: | [9S-(9α,10β,11β,13α)]-2,3,10,11,12,13-Hexahydro-10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one |
| Purity: | ≥98% |
Alkylating agent; chemotherapeutic
| Chemical Name: | 2-[bis(2-Chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide |
| Purity: | ≥98% |
Antibiotic; inhibits 50S ribosomal subunit formation and elongation at transpeptidation
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥98% |
Synthetic thymidine analog; used for cell proliferation assays
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥98% |
Potent flap endonuclease 1 (FEN1) inhibitor; induces DNA damage response
| Chemical Name: | 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-3-hydroxythieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% |
Reagent for RNA SHAPE-MaP chemistry
| Alternate Names: | 1-Methyl-7-nitroisatoic anhydride |
| Chemical Name: | 1-Methyl-7-nitro-2H-3,1-benzoxazine-2,4(1H)-dione |
| Purity: | ≥95% |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% |
Photoreactive uridine analog for RNA sequencing
| Chemical Name: | 4-Thiouridine |
| Purity: | ≥98% |
Reagent for RNA SHAPE-MaP experiments in vivo; cell permeable
| Chemical Name: | (2-Aminopyridin-3-yl)(1H-imidazol-1-yl)methanone |
Selective orthosteric inhibitor of the BRCA2-RAD51 interaction
| Chemical Name: | N-(2-((2S,4R)-2-(((S)-1-(2-Chloro-4-methoxyphenyl)ethyl)carbamoyl)-4-hydroxypyrrolidin-1-yl)-2-oxoethyl)-6-fluoroquinoline-2-carboxamide |
| Purity: | ≥98% |
Hypoxia-activated DNA alkylating agent prodrug
| Chemical Name: | (1-Methyl-2-nitro-1H-imidazol-5-yl)methyl N,N'-bis(2-bromoethyl)phosphorodiamidate |
| Purity: | ≥98% |
Potent and selective DYRK1A inhibitor
| Chemical Name: | 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| Purity: | ≥98% |
HIV RNA splicing modulator
| Chemical Name: | 8-Chloro-N-[4-(trifluoromethoxy)phenyl]-2-quinolinamine |
| Purity: | ≥98% |
RNA conformation probe; reagent for COMRADES RNA platform
| Alternate Names: | psoralen-triethylene glycol azide |
| Chemical Name: | 3-(13-Azido-5,8,11-trioxa-2-azatridec-1-yl)-2,5,9-trimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Purity: | ≥98% |
Modulator of alternative polyadenylation; inhibits rod photoreceptor gene expression via Nr2e3
| Chemical Name: | 6,7-Dimethoxy-2-[((4-phenyl-3,6-dihydropyridin-1(2H)-yl)methyl)]quinazolin-4(3H)-one |
| Purity: | ≥98% |
Uridine analog, used for labeling RNA synthesis
| Chemical Name: | 1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-ethynylpyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% |
Thymidine analog for labeling DNA; can be linked to a fluorophore by click chemistry
| Chemical Name: | 5-ethynyl-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥95% |
Potent and selective herpes simplex virus (HSV) helicase primase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-4-methyl-2-thiazolyl]-N-methyl-4-(2-pyridinyl)benzeneacetamide |
| Purity: | ≥98% |
Binds to SARS-CoV-2 frameshifting element and reduces frameshifting efficiency
| Chemical Name: | 3-[[4-(Methylamino)-2-quinazolinyl]amino]benzoic acid |
| Purity: | ≥98% |
IKBKAP pre-mRNA splicing modulator
| Chemical Name: | 2-Chloro-N-(2-furanylmethyl)-7H-purin-6-amine |
| Purity: | ≥98% |
eIF4A inhibitor
| Chemical Name: | 2-(5-(4-Butylphenyl)furan-2-yl)-6-nitroquinoline-4-carboxylic acid |
| Purity: | ≥98% |
Auxin antagonist of TIR1/AFB receptors; also OsTIR1 inhibitor in auxin-inducible degron (AID) system
| Chemical Name: | α-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-indole-3-acetic acid |
| Purity: | ≥98% |
Selective SMN2 gene splicing modifier
| Chemical Name: | 7-(4,7-Diazaspiro[2.5]oct-7-yl)-2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Purity: | ≥98% |
Metabolite generated by cytosol nonspecific dipeptidase (CNDP2) during intense exercise
| Chemical Name: | N-[(2S)-2-Hydroxy-1-oxopropyl]-L-phenylalanine |
| Purity: | ≥95% |
Reagent for modifying RNA at 2'-OH position, for SHAPE-MAP experiments
| Chemical Name: | 3-((1H-1,2,4-Triazol-1-yl)sulfonyl)pyridine |
| Purity: | ≥95% |
