25 results for "Autophagy Inhibitors Small Molecules and Peptides" in Products
Autophagy Inhibitors Small Molecules and Peptides
Autophagy is a process by which a cell breaks down macromolecules in response to starvation or stress signals. While it is closely linked with apoptosis, autophagy is primarily characterized as a catabolic mechanism by which cellular energy homeostasis is maintained, and by which cellular organelles and proteins are degraded.
Autophagy also occurs in response to similar stresses to those which induce apoptosis and several proapoptotic signals also induce autophagy - for example, ...
Prototypical PI 3-kinase inhibitor; also inhibits other kinases
| Chemical Name: | 2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one hydrochloride |
| Purity: | ≥99% |
H+-ATPase (vacuolar) inhibitor
| Chemical Name: | (3Z,5E,7R,8S,9S,11E,13E,15S,16R)-8-Hydroxy-16-[(1S,2R,3S)-2-hydroxy-1-methyl-3-[(2R,4R,5S,6R)-tetrahydro-2,4-dihydroxy-5-methyl-6-(1-methylethyl)-2H-pyran-2-yl]butyl]-3,15-dimethoxy-5,7,9,11-tetramethyloxacyclohexadeca-3,5,11,13-tetraen-2-one |
| Purity: | ≥95% |
Promotes assembly and inhibits disassembly of microtubules
| Alternate Names: | Paclitaxel |
| Chemical Name: | [2aR-[2aα,4β,4aβ,6α,9α(αR*,βS*),11α,12α,12aα,12bα]]-β-(Benzoylamino)-α-hydroxy-6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester benzenepropanoic acid |
| Purity: | ≥98% |
Selective and high affinity cathepsin D inhibitor
| Purity: | ≥95% |
Potent, irreversible inhibitor of PI 3-kinase. Also inhibitor of PLK1
| Alternate Names: | SL-2052 |
| Chemical Name: | (1S,6bR,9aS,11R,11bR) 11-(Acetyloxy)-1,6b,7,8,9a,10,11,11b-octahydro-1-(methoxymethyl)-9a,11b-dimethyl-3H-furo[4,3,2-de]indeno[4,5,-h]-2-h]-2-benzopyran-3,6,9-trione |
| Purity: | ≥98% |
Selective farnesoid X receptor (FXR) agonist
| Chemical Name: | 3-[2-[2-Chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]phenyl]ethenyl]benzoic acid |
| Purity: | ≥97% |
Microtubule inhibitor
| Chemical Name: | [5-(2-Thienylcarbonyl)-1H-benzimidazol-2-yl]carbamic acid methyl ester |
| Purity: | ≥95% |
Antimalarial; inhibits apoptosis and autophagy
| Chemical Name: | N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt |
| Purity: | ≥98% |
Cathepsin inhibitor; interferes with autolysosomal digestion
| Chemical Name: | (2S,3S)-3-[[[(1S)-3-Methyl-1-[[(3-methylbutyl)amino]carbonyl]butyl]amino]carbonyl]-2-oxiranecarboxylic acid ethyl ester |
| Purity: | ≥98% |
H+-ATPase (vacuolar) inhibitor
| Alternate Names: | Folimycin |
| Chemical Name: | (3Z,5E,7R,8R,9S,10S,11R,13E,15E,17S,18R)-18-[(1S,2R,3S)-3-[(2R,4R,5S,6R)-4-[[4-O-(Aminocarbonyl)-2,6-dideoxy-β-D-arabino-hexopyranosyl]oxy]tetrahydro-2-hydroxy-5-methyl-6-(1E)-1-propenyl-2H-pyran-2-yl]-2-hydroxy-1-methylbutyl]-9-ethyl-8,10-dihydroxy-3,17-dimethoxy-5,7,11,13-tetramethyloxacyclooctadeca-3,5,13,15-tetraen-2-one |
| Purity: | ≥90% |
CaV1.x activator
| Chemical Name: | 1,4-Dihydro-2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid, methyl ester |
| Purity: | ≥98% |
HMG-CoA reductase inhibitor
| Chemical Name: | (1S,3R,7S,8S,8aR)-1,2,3,7,8,8a-Hexahydro-3,7-dimethyl-8-[2-[(2R,4R)-tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl]ethyl]-1-naphthalenyly-2,2-dimethyl butanoate |
| Purity: | ≥98% |
Antibiotic; inhibits 50S ribosomal subunit formation and elongation at transpeptidation
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥98% |
Class III PI 3-kinase inhibitor; also inhibits autophagy
| Alternate Names: | 3-MA |
| Chemical Name: | 3-Methyl-3H-purin-6-amine |
| Purity: | ≥98% |
Disrupts microtubules
| Chemical Name: | Vincaleukoblastine |
| Purity: | ≥95% |
Selective dynamin inhibitor; attenuates mitochondrial division and apoptosis
| Chemical Name: | 3-(2,4-Dichloro-5-methoxyphenyl)-2,3-dihydro-2-thioxo-4(1H)-quinazolinone |
| Purity: | ≥98% |
USP10 and USP13 inhibitor; inhibits autophagy
| Chemical Name: | 6-Fluoro-N-[(4-Fluorophenyl)methyl]-4-quinazolinamine |
| Purity: | ≥98% |
Autophagy inhibitor; also TLR9 inhibitor
| Chemical Name: | 2-[[4-[(7-Chloro-4-quinolinyl)amino]pentyl]ethylamino]ethanol sulfate |
| Purity: | ≥98% |
Potent and selective p97 ATPase (VCP) allosteric inhibitor
| Chemical Name: | 3-[3-(Cyclopentylthio)-5-[[[2-methyl-4'-(methylsulfonyl)[1,1'-biphenyl]-4-yl]oxy]methyl]-4H-1,2,4-triazol-4-yl]pyridine |
| Purity: | ≥98% |
Potent TBK inhibitor
| Chemical Name: | N-[3-[[5-Cyclopropyl-2-[[4-(4-morpholinyl)phenyl]amino]-4-pyrimidinyl]amino]propyl]cyclobutanecarboxamide hydrochloride |
| Purity: | ≥98% |
Salt inducible kinase (SIK) inhibitor; also ULK1 and 2 inhibitor
| Chemical Name: | N-[3-[[5-Cyclopropyl-2-[[3-(4-morpholinylmethyl)phenyl]amino]-4-pyrimidinyl]amino]propyl]cyclobutanecarboxamide dihydrochloride |
| Purity: | ≥98% |
ATP-competitive inhibitor of p97 ATPase
| Chemical Name: | 2-(2-Amino-1H-benzimidazole-1-yl)-8-methoxy-N-(phenylmethyl)-4-quinazolinamine |
| Purity: | ≥98% |
Potent and selective Foxo1 inhibitor; orally bioavailable
| Chemical Name: | 5-Amino-7-(cyclohexylamino)-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid |
| Purity: | ≥98% |
ULK inhibitor
| Chemical Name: | N-[3-[[5-Cyclopropyl-2-[(1,2,3,4-tetrahydro-2-methyl-6-isoquinolinyl)amino]-4-pyrimidinyl]amino]propyl]cyclobutanecarboxamide dihydrochloride |
| Purity: | ≥98% |
Potent VPS34 inhibitor
| Chemical Name: | 6-Chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenoxy)-pyrimidinamine |
| Purity: | ≥98% |