67 results for "Coronavirus Antiviral Compounds Small Molecules and Peptides" in Products
Coronavirus Antiviral Compounds Small Molecules and Peptides
Coronaviruses are spherical viruses with a large genome (approximately 27 to 32 kb) enclosed in a lipid bilayer with surface glycoprotein projections that give the virus the appearance of having a crown, hence the name coronavirus. There are four types of coronavirus: Alphacoronaviruses and Betacoronaviruses infect only mammals, while Gammacoronavirus and Deltacoronavirus infect birds. In humans coronaviruses cause respiratory tract infections with symptoms ranging from mild, similar to the ...
DNA synthesis inhibitor
| Chemical Name: | (+)-2'-Deoxy-2',2'-difluorocytidine hydrochloride |
| Purity: | ≥98% |
Calcineurin inhibitor
| Alternate Names: | Ciclosporin A |
| Purity: | ≥98% |
Potent inhibitor of SERCA ATPase
| Chemical Name: | (3S,3aR,4S,6S,6AR,7S,8S,9bS)-6-(Acetyloxy)-2,3,3a,4,5,6,6a,7,8,9b-decahydro-3,3a-dihydroxy-3,6,9-trimethyl-8-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-2-oxo-4-(1-oxobutoxy)azuleno[4,5-b]furan-7-yl octanoate |
| Purity: | ≥97% |
mTOR inhibitor; immunosuppressant
| Chemical Name: | (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-Hexadecahydro-9,27-dihydroxy-3-[(1R)-2-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethyl]-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-23,27-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| Purity: | ≥98% |
Activator of LKB1/AMPK; antidiabetic agent
| Chemical Name: | N,N-Dimethylimidodicarbonimidic diamide hydrochloride |
Na+/K+ ATPase inhibitor
| Chemical Name: | 3-[(6-Deoxy-α-L-mannopyranosyl)oxy]-1,5,11α,14,19-pentahydoxycard-20(22)-enolide |
| Purity: | ≥95% |
STAT3 inhibitor; also inhibits mTORC1 signaling
| Chemical Name: | 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| Purity: | ≥98% |
Inhibitor of protein synthesis
| Chemical Name: | 4-[2-(3,5-Dimethyl-2-oxo-cyclohexyl)-2-hydroxyethyl]-2,6-piperidinedione |
| Purity: | ≥97% |
Histone deacetylase inhibitor
| Alternate Names: | VPA,Sodium Valproate |
| Chemical Name: | Sodium 2-propylpentanoate |
Antimalarial; inhibits apoptosis and autophagy
| Chemical Name: | N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt |
| Purity: | ≥98% |
Potent and selective BET bromodomain inhibitor; cell permeable
| Chemical Name: | (6S)-4-(4-Chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetic acid 1,1-dimethylethyl ester |
| Purity: | ≥98% |
MRP and OAT3 inhibitor
| Chemical Name: | 4-(Dipropylsulfamoyl)benzoic acid |
| Purity: | ≥98% |
Highly potent pan-Src/Bcr-Abl inhibitor
| Alternate Names: | BMS-354825 |
| Chemical Name: | N-(2-Chloro-6-methylphenyl)-2-[[6-[4-(2-hydroxyethyl)-1-piperazinyl]-2-methyl-4-pyrimidinyl]amino]-5-thiazolecarboxamide |
| Purity: | ≥98% |
Cyclooxygenase inhibitor (COX-1 > COX-2)
| Chemical Name: | 1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indole |
| Purity: | ≥98% |
Potent calcineurin inhibitor; immunosuppressant
| Alternate Names: | Tacrolimus,Fujimycin |
| Chemical Name: | (3S,4R,5S,8R,9E,12S,14S,15R,16S,18R,19R,26aS)-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a-Hexadecahydro-5,19-dihydroxy-3-[(1E)-2-[(1R,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethenyl]-14,16-dimethoxy-4,10,12,18-tetramethyl-8-(2-propen-1-yl)-15,19-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclotricosine-1,7,20,21(4H,23H)tetrone |
| Purity: | ≥98% |
Reversibly stimulates SERCA Ca2+-ATPase; displays a range of other activities
| Alternate Names: | Tetraethylthiuram disulfide |
| Chemical Name: | Bis(diethylthiocarbamyoyl)disulfide |
Cathepsin inhibitor; interferes with autolysosomal digestion
| Chemical Name: | (2S,3S)-3-[[[(1S)-3-Methyl-1-[[(3-methylbutyl)amino]carbonyl]butyl]amino]carbonyl]-2-oxiranecarboxylic acid ethyl ester |
| Purity: | ≥98% |
Antimicrobial peptide derivative of human cathelicidin
| Purity: | ≥95% |
Potent and selective v-Abl tyrosine kinase inhibitor; also inhibits PDGFR and c-kit
| Alternate Names: | Gleevec,CGP 57148B |
| Chemical Name: | 4-[(4-Methyl-1-piperazinyl)methyl]-N-[4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]benzamide methanesulfonate |
| Purity: | ≥98% |
Potent and selective JAK1/JAK2 inhibitor; orally bioavailable
| Alternate Names: | INCB018424 |
| Chemical Name: | (3R)-3-Cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl]propanenitrile |
| Purity: | ≥98% |
Non-selective PI 3-kinase inhibitor
| Chemical Name: | 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one |
| Purity: | ≥98% |
PPARα antagonist
| Chemical Name: | N-((2S)-2-(((1Z)-1-Methyl-3-oxo-3-(4-(trifluoromethyl)phenyl)prop-1-enyl)amino)-3-(4-(2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy)phenyl)propyl)propanamide |
| Purity: | ≥98% |
Viral RNA-dependent RNA polymerase (RdRP) inhibitor; broad spectrum antiviral nucleotide prodrug
| Alternate Names: | GS-5734 |
| Chemical Name: | 2-Ethylbutyl (2S)-2-[[(S)-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo(2,1-f)(1,2,4)triazin-7-yl)-5-cyano-3,4-dihydroxytetrahydrofuran-2-yl]methoxy]phenoxyphosphoryl]amino]propanoate |
| Purity: | ≥98% |
DNA topoisomerase II inhibitor
| Alternate Names: | Daunomycin |
| Chemical Name: | (8S,10S)-8-Acetyl-10-[(3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyransoyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-5,12-naphthacenedione hydrochloride |
| Purity: | ≥98% |
Serine protease inhibitor; inhibits tryptase
| Chemical Name: | 4-[(Aminoiminomethyl)amino]benzoic acid 6-(aminoiminomethyl)-2-naphthalenyl ester dimethanesulfonate |
| Purity: | ≥98% |